C12H11BrF4O2 — CID 146009203
4-bromo-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one (PubChem CID 146009203) has the molecular formula C12H11BrF4O2 and a molecular weight of 343.11 g/mol. Its IUPAC name is 4-bromo-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one.
| Compound Name | 4-bromo-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one |
|---|---|
| PubChem CID | 146009203 |
| Molecular Formula | C12H11BrF4O2 |
| Molecular Weight | 343.11 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 4-bromo-1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one |
| SMILES | O=C(CCCBr)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H11BrF4O2/c13-6-2-5-10(18)8-3-1-4-9(7-8)19-12(16,17)11(14)15/h1,3-4,7,11H,2,5-6H2 |
| InChIKey | FQXVWJVBZLULFY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.11 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|