C16H18F4N2O2 — CID 4866547
N-(cycloheptylideneamino)-3-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 4866547) has the molecular formula C16H18F4N2O2 and a molecular weight of 346.32 g/mol. Its IUPAC name is N-(cycloheptylideneamino)-3-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-(cycloheptylideneamino)-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 4866547 |
| Molecular Formula | C16H18F4N2O2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-(cycloheptylideneamino)-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | O=C(NN=C1CCCCCC1)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C16H18F4N2O2/c17-15(18)16(19,20)24-13-9-5-6-11(10-13)14(23)22-21-12-7-3-1-2-4-8-12/h5-6,9-10,15H,1-4,7-8H2,(H,22,23) |
| InChIKey | WELBOLJGGQDYST-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|