C14H18F4N3O2+ — CID 2316979
N-(4-methylpiperazin-4-ium-1-yl)-3-(1,1,2,2-tetrafluoroethoxy)benzamide (PubChem CID 2316979) has the molecular formula C14H18F4N3O2+ and a molecular weight of 336.31 g/mol. Its IUPAC name is N-(4-methylpiperazin-4-ium-1-yl)-3-(1,1,2,2-tetrafluoroethoxy)benzamide.
| Compound Name | N-(4-methylpiperazin-4-ium-1-yl)-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
|---|---|
| PubChem CID | 2316979 |
| Molecular Formula | C14H18F4N3O2+ |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N-(4-methylpiperazin-4-ium-1-yl)-3-(1,1,2,2-tetrafluoroethoxy)benzamide |
| SMILES | C[NH+]1CCN(NC(=O)c2cccc(OC(F)(F)C(F)F)c2)CC1 |
| InChI | InChI=1S/C14H17F4N3O2/c1-20-5-7-21(8-6-20)19-12(22)10-3-2-4-11(9-10)23-14(17,18)13(15)16/h2-4,9,13H,5-8H2,1H3,(H,19,22)/p+1 |
| InChIKey | BCXTYOYMULYMSJ-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|