C19H24F4N2O4 — CID 71512903
tert-butyl N-[1-[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]piperidin-4-yl]carbamate (PubChem CID 71512903) has the molecular formula C19H24F4N2O4 and a molecular weight of 420.40 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 71512903 |
| Molecular Formula | C19H24F4N2O4 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | tert-butyl N-[1-[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)c2cccc(OC(F)(F)C(F)F)c2)CC1 |
| InChI | InChI=1S/C19H24F4N2O4/c1-18(2,3)29-17(27)24-13-7-9-25(10-8-13)15(26)12-5-4-6-14(11-12)28-19(22,23)16(20)21/h4-6,11,13,16H,7-10H2,1-3H3,(H,24,27) |
| InChIKey | LJQSVUFTRJYQIJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|