C16H17F7N2O4 — CID 71514931
(4-aminopiperidin-1-yl)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 71514931) has the molecular formula C16H17F7N2O4 and a molecular weight of 434.31 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (4-aminopiperidin-1-yl)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71514931 |
| Molecular Formula | C16H17F7N2O4 |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | NC1CCN(C(=O)c2cccc(OC(F)(F)C(F)F)c2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H16F4N2O2.C2HF3O2/c15-13(16)14(17,18)22-11-3-1-2-9(8-11)12(21)20-6-4-10(19)5-7-20;3-2(4,5)1(6)7/h1-3,8,10,13H,4-7,19H2;(H,6,7) |
| InChIKey | NTBRBZKYAKUUHD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|