C17H19F4NO2 — CID 171945486
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone (PubChem CID 171945486) has the molecular formula C17H19F4NO2 and a molecular weight of 345.34 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone.
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 171945486 |
| Molecular Formula | C17H19F4NO2 |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methanone |
| SMILES | CN1C2CCC1CC(C(=O)c1cccc(OC(F)(F)C(F)F)c1)C2 |
| InChI | InChI=1S/C17H19F4NO2/c1-22-12-5-6-13(22)8-11(7-12)15(23)10-3-2-4-14(9-10)24-17(20,21)16(18)19/h2-4,9,11-13,16H,5-8H2,1H3 |
| InChIKey | YPKALIUOTACDLE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|