C17H21F4NO2 — CID 171959680
9-methyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 171959680) has the molecular formula C17H21F4NO2 and a molecular weight of 347.35 g/mol. Its IUPAC name is 9-methyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9-methyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171959680 |
| Molecular Formula | C17H21F4NO2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 9-methyl-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | CN1C2CCCC1CC(O)(c1cccc(OC(F)(F)C(F)F)c1)C2 |
| InChI | InChI=1S/C17H21F4NO2/c1-22-12-5-3-6-13(22)10-16(23,9-12)11-4-2-7-14(8-11)24-17(20,21)15(18)19/h2,4,7-8,12-13,15,23H,3,5-6,9-10H2,1H3 |
| InChIKey | NFNXOEBDAZDMQY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|