C21H23F2NO2 — CID 171954689
8-benzyl-3-[3-(difluoromethoxy)phenyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171954689) has the molecular formula C21H23F2NO2 and a molecular weight of 359.42 g/mol. Its IUPAC name is 8-benzyl-3-[3-(difluoromethoxy)phenyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-benzyl-3-[3-(difluoromethoxy)phenyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171954689 |
| Molecular Formula | C21H23F2NO2 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 8-benzyl-3-[3-(difluoromethoxy)phenyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(c2cccc(OC(F)F)c2)CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C21H23F2NO2/c22-20(23)26-19-8-4-7-16(11-19)21(25)12-17-9-10-18(13-21)24(17)14-15-5-2-1-3-6-15/h1-8,11,17-18,20,25H,9-10,12-14H2 |
| InChIKey | KOWFOZQNAJAVNA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |