C23H24FNO2 — CID 98137123
(1R,5R)-3-(3-fluorophenyl)-8-[(3-prop-2-ynoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 98137123) has the molecular formula C23H24FNO2 and a molecular weight of 365.45 g/mol. Its IUPAC name is (1R,5R)-3-(3-fluorophenyl)-8-[(3-prop-2-ynoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,5R)-3-(3-fluorophenyl)-8-[(3-prop-2-ynoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 98137123 |
| Molecular Formula | C23H24FNO2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (1R,5R)-3-(3-fluorophenyl)-8-[(3-prop-2-ynoxyphenyl)methyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | C#CCOc1cccc(CN2[C@@H]3CC[C@@H]2CC(O)(c2cccc(F)c2)C3)c1 |
| InChI | InChI=1S/C23H24FNO2/c1-2-11-27-22-8-3-5-17(12-22)16-25-20-9-10-21(25)15-23(26,14-20)18-6-4-7-19(24)13-18/h1,3-8,12-13,20-21,26H,9-11,14-16H2/t20-,21-/m1/s1 |
| InChIKey | MILWZOKYKIACDL-NHCUHLMSSA-N |
| XLogP | 3.85 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|