C21H23F2NO2 — CID 171954789
8-benzyl-3-(3,4-difluoro-5-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171954789) has the molecular formula C21H23F2NO2 and a molecular weight of 359.42 g/mol. Its IUPAC name is 8-benzyl-3-(3,4-difluoro-5-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-benzyl-3-(3,4-difluoro-5-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171954789 |
| Molecular Formula | C21H23F2NO2 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 8-benzyl-3-(3,4-difluoro-5-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1cc(C2(O)CC3CCC(C2)N3Cc2ccccc2)cc(F)c1F |
| InChI | InChI=1S/C21H23F2NO2/c1-26-19-10-15(9-18(22)20(19)23)21(25)11-16-7-8-17(12-21)24(16)13-14-5-3-2-4-6-14/h2-6,9-10,16-17,25H,7-8,11-13H2,1H3 |
| InChIKey | CTFPOIDDZLIPHP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |