C20H21F3N2O — CID 171954342
8-benzyl-3-[2-(trifluoromethyl)-4-pyridinyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171954342) has the molecular formula C20H21F3N2O and a molecular weight of 362.39 g/mol. Its IUPAC name is 8-benzyl-3-[2-(trifluoromethyl)-4-pyridinyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-benzyl-3-[2-(trifluoromethyl)-4-pyridinyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171954342 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 8-benzyl-3-[2-(trifluoromethyl)-4-pyridinyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(c2ccnc(C(F)(F)F)c2)CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C20H21F3N2O/c21-20(22,23)18-10-15(8-9-24-18)19(26)11-16-6-7-17(12-19)25(16)13-14-4-2-1-3-5-14/h1-5,8-10,16-17,26H,6-7,11-13H2 |
| InChIKey | QULONSVLOCCJBM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |