C21H21F4NO2 — CID 171956781
8-benzyl-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171956781) has the molecular formula C21H21F4NO2 and a molecular weight of 395.40 g/mol. Its IUPAC name is 8-benzyl-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-benzyl-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171956781 |
| Molecular Formula | C21H21F4NO2 |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 8-benzyl-3-[3-fluoro-4-(trifluoromethoxy)phenyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(c2ccc(OC(F)(F)F)c(F)c2)CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C21H21F4NO2/c22-18-10-15(6-9-19(18)28-21(23,24)25)20(27)11-16-7-8-17(12-20)26(16)13-14-4-2-1-3-5-14/h1-6,9-10,16-17,27H,7-8,11-13H2 |
| InChIKey | YMBKFVQWIWCHCK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |