C21H25NO2 — CID 13091234
(1R,5S)-8-benzyl-3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 13091234) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (1R,5S)-8-benzyl-3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,5S)-8-benzyl-3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 13091234 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (1R,5S)-8-benzyl-3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1ccc(C2(O)C[C@H]3CC[C@@H](C2)N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NO2/c1-24-20-11-7-17(8-12-20)21(23)13-18-9-10-19(14-21)22(18)15-16-5-3-2-4-6-16/h2-8,11-12,18-19,23H,9-10,13-15H2,1H3/t18-,19+,21? |
| InChIKey | DVOPRKZTGKARBK-PMSBKCLSSA-N |
| XLogP | 3.71 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |