C25H31NO4 — CID 98137280
(1S,5S)-8-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methyl]-3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 98137280) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (1S,5S)-8-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methyl]-3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,5S)-8-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methyl]-3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 98137280 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (1S,5S)-8-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methyl]-3-(4-methoxyphenyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | C=CCc1cc(CN2[C@H]3CC[C@H]2CC(O)(c2ccc(OC)cc2)C3)cc(OC)c1O |
| InChI | InChI=1S/C25H31NO4/c1-4-5-18-12-17(13-23(30-3)24(18)27)16-26-20-8-9-21(26)15-25(28,14-20)19-6-10-22(29-2)11-7-19/h4,6-7,10-13,20-21,27-28H,1,5,8-9,14-16H2,2-3H3/t20-,21-/m0/s1 |
| InChIKey | IURQOJBLZMDDEA-SFTDATJTSA-N |
| XLogP | 4.15 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|