C24H27F2NO2 — CID 171949096
1-(9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-2-[3-(difluoromethoxy)phenyl]ethanone (PubChem CID 171949096) has the molecular formula C24H27F2NO2 and a molecular weight of 399.48 g/mol. Its IUPAC name is 1-(9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-2-[3-(difluoromethoxy)phenyl]ethanone.
| Compound Name | 1-(9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-2-[3-(difluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 171949096 |
| Molecular Formula | C24H27F2NO2 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 1-(9-benzyl-9-azabicyclo[3.3.1]nonan-3-yl)-2-[3-(difluoromethoxy)phenyl]ethanone |
| SMILES | O=C(Cc1cccc(OC(F)F)c1)C1CC2CCCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C24H27F2NO2/c25-24(26)29-22-11-4-8-18(12-22)13-23(28)19-14-20-9-5-10-21(15-19)27(20)16-17-6-2-1-3-7-17/h1-4,6-8,11-12,19-21,24H,5,9-10,13-16H2 |
| InChIKey | DKWSHIRYMSEJEO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |