C23H23F4NO — CID 171942925
1-(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethanone (PubChem CID 171942925) has the molecular formula C23H23F4NO and a molecular weight of 405.44 g/mol. Its IUPAC name is 1-(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171942925 |
| Molecular Formula | C23H23F4NO |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-2-[3-fluoro-5-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(Cc1cc(F)cc(C(F)(F)F)c1)C1CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C23H23F4NO/c24-19-9-16(8-18(13-19)23(25,26)27)10-22(29)17-11-20-6-7-21(12-17)28(20)14-15-4-2-1-3-5-15/h1-5,8-9,13,17,20-21H,6-7,10-12,14H2 |
| InChIKey | XLEHUZSMUKBSGG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |