C21H19F4NO — CID 171941142
(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(2,3,5,6-tetrafluorophenyl)methanone (PubChem CID 171941142) has the molecular formula C21H19F4NO and a molecular weight of 377.38 g/mol. Its IUPAC name is (8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(2,3,5,6-tetrafluorophenyl)methanone.
| Compound Name | (8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(2,3,5,6-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 171941142 |
| Molecular Formula | C21H19F4NO |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(2,3,5,6-tetrafluorophenyl)methanone |
| SMILES | O=C(c1c(F)c(F)cc(F)c1F)C1CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C21H19F4NO/c22-16-10-17(23)20(25)18(19(16)24)21(27)13-8-14-6-7-15(9-13)26(14)11-12-4-2-1-3-5-12/h1-5,10,13-15H,6-9,11H2 |
| InChIKey | JRCVKZXITNGKES-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|