C20H20F2N2O — CID 171943598
(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(2,6-difluoro-3-pyridinyl)methanone (PubChem CID 171943598) has the molecular formula C20H20F2N2O and a molecular weight of 342.39 g/mol. Its IUPAC name is (8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(2,6-difluoro-3-pyridinyl)methanone.
| Compound Name | (8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(2,6-difluoro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 171943598 |
| Molecular Formula | C20H20F2N2O |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(2,6-difluoro-3-pyridinyl)methanone |
| SMILES | O=C(c1ccc(F)nc1F)C1CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C20H20F2N2O/c21-18-9-8-17(20(22)23-18)19(25)14-10-15-6-7-16(11-14)24(15)12-13-4-2-1-3-5-13/h1-5,8-9,14-16H,6-7,10-12H2 |
| InChIKey | VBCUNDXOUPIQHO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|