C20H23N3O — CID 171950606
(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(4-methylpyrimidin-2-yl)methanone (PubChem CID 171950606) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(4-methylpyrimidin-2-yl)methanone.
| Compound Name | (8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(4-methylpyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 171950606 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)-(4-methylpyrimidin-2-yl)methanone |
| SMILES | Cc1ccnc(C(=O)C2CC3CCC(C2)N3Cc2ccccc2)n1 |
| InChI | InChI=1S/C20H23N3O/c1-14-9-10-21-20(22-14)19(24)16-11-17-7-8-18(12-16)23(17)13-15-5-3-2-4-6-15/h2-6,9-10,16-18H,7-8,11-13H2,1H3 |
| InChIKey | KYEJCRKNVMNETI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |