C22H21FN2O — CID 171946638
2-(8-benzyl-8-azabicyclo[3.2.1]octane-3-carbonyl)-6-fluorobenzonitrile (PubChem CID 171946638) has the molecular formula C22H21FN2O and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-(8-benzyl-8-azabicyclo[3.2.1]octane-3-carbonyl)-6-fluorobenzonitrile.
| Compound Name | 2-(8-benzyl-8-azabicyclo[3.2.1]octane-3-carbonyl)-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 171946638 |
| Molecular Formula | C22H21FN2O |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-(8-benzyl-8-azabicyclo[3.2.1]octane-3-carbonyl)-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)cccc1C(=O)C1CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C22H21FN2O/c23-21-8-4-7-19(20(21)13-24)22(26)16-11-17-9-10-18(12-16)25(17)14-15-5-2-1-3-6-15/h1-8,16-18H,9-12,14H2 |
| InChIKey | JMRJSNXRDNSABY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |