C21H27F4NO4 — CID 171959682
tert-butyl 3-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 171959682) has the molecular formula C21H27F4NO4 and a molecular weight of 433.44 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 171959682 |
| Molecular Formula | C21H27F4NO4 |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | tert-butyl 3-hydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-9-azabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCCC1CC(O)(c1cccc(OC(F)(F)C(F)F)c1)C2 |
| InChI | InChI=1S/C21H27F4NO4/c1-19(2,3)30-18(27)26-14-7-5-8-15(26)12-20(28,11-14)13-6-4-9-16(10-13)29-21(24,25)17(22)23/h4,6,9-10,14-15,17,28H,5,7-8,11-12H2,1-3H3 |
| InChIKey | NROABZORIXGHGT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|