C15H19F3N2O — CID 171954521
9-methyl-3-[5-(trifluoromethyl)-3-pyridinyl]-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 171954521) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is 9-methyl-3-[5-(trifluoromethyl)-3-pyridinyl]-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9-methyl-3-[5-(trifluoromethyl)-3-pyridinyl]-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171954521 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 9-methyl-3-[5-(trifluoromethyl)-3-pyridinyl]-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | CN1C2CCCC1CC(O)(c1cncc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C15H19F3N2O/c1-20-12-3-2-4-13(20)7-14(21,6-12)10-5-11(9-19-8-10)15(16,17)18/h5,8-9,12-13,21H,2-4,6-7H2,1H3 |
| InChIKey | NNQXLTNPDLHXRA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |