C17H22F3NO — CID 171963965
9-methyl-3-[2-methyl-5-(trifluoromethyl)phenyl]-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 171963965) has the molecular formula C17H22F3NO and a molecular weight of 313.36 g/mol. Its IUPAC name is 9-methyl-3-[2-methyl-5-(trifluoromethyl)phenyl]-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 9-methyl-3-[2-methyl-5-(trifluoromethyl)phenyl]-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171963965 |
| Molecular Formula | C17H22F3NO |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 9-methyl-3-[2-methyl-5-(trifluoromethyl)phenyl]-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | Cc1ccc(C(F)(F)F)cc1C1(O)CC2CCCC(C1)N2C |
| InChI | InChI=1S/C17H22F3NO/c1-11-6-7-12(17(18,19)20)8-15(11)16(22)9-13-4-3-5-14(10-16)21(13)2/h6-8,13-14,22H,3-5,9-10H2,1-2H3 |
| InChIKey | LPJPFZFVYHAWLG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |