C17H24FNO — CID 171962228
3-[(3-fluoro-4-methylphenyl)methyl]-9-methyl-9-azabicyclo[3.3.1]nonan-3-ol (PubChem CID 171962228) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is 3-[(3-fluoro-4-methylphenyl)methyl]-9-methyl-9-azabicyclo[3.3.1]nonan-3-ol.
| Compound Name | 3-[(3-fluoro-4-methylphenyl)methyl]-9-methyl-9-azabicyclo[3.3.1]nonan-3-ol |
|---|---|
| PubChem CID | 171962228 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3-[(3-fluoro-4-methylphenyl)methyl]-9-methyl-9-azabicyclo[3.3.1]nonan-3-ol |
| SMILES | Cc1ccc(CC2(O)CC3CCCC(C2)N3C)cc1F |
| InChI | InChI=1S/C17H24FNO/c1-12-6-7-13(8-16(12)18)9-17(20)10-14-4-3-5-15(11-17)19(14)2/h6-8,14-15,20H,3-5,9-11H2,1-2H3 |
| InChIKey | YIDSACOTSUVABD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |