C12H14F2O — CID 103564715
1-[(3,4-difluorophenyl)methyl]-3-methylcyclobutan-1-ol (PubChem CID 103564715) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-methylcyclobutan-1-ol.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 103564715 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-methylcyclobutan-1-ol |
| SMILES | CC1CC(O)(Cc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C12H14F2O/c1-8-5-12(15,6-8)7-9-2-3-10(13)11(14)4-9/h2-4,8,15H,5-7H2,1H3 |
| InChIKey | SZZURTFJLABUHH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |