C16H22F2O — CID 107449890
1-[(3,4-difluorophenyl)methyl]-3-propan-2-ylcyclohexan-1-ol (PubChem CID 107449890) has the molecular formula C16H22F2O and a molecular weight of 268.35 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-propan-2-ylcyclohexan-1-ol.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 107449890 |
| Molecular Formula | C16H22F2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-propan-2-ylcyclohexan-1-ol |
| SMILES | CC(C)C1CCCC(O)(Cc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C16H22F2O/c1-11(2)13-4-3-7-16(19,10-13)9-12-5-6-14(17)15(18)8-12/h5-6,8,11,13,19H,3-4,7,9-10H2,1-2H3 |
| InChIKey | SXGXWJXDURURCC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |