C11H11ClF2 — CID 82935489
4-[[1-(chloromethyl)cyclopropyl]methyl]-1,2-difluorobenzene (PubChem CID 82935489) has the molecular formula C11H11ClF2 and a molecular weight of 216.66 g/mol. Its IUPAC name is 4-[[1-(chloromethyl)cyclopropyl]methyl]-1,2-difluorobenzene.
| Compound Name | 4-[[1-(chloromethyl)cyclopropyl]methyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 82935489 |
| Molecular Formula | C11H11ClF2 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4-[[1-(chloromethyl)cyclopropyl]methyl]-1,2-difluorobenzene |
| SMILES | Fc1ccc(CC2(CCl)CC2)cc1F |
| InChI | InChI=1S/C11H11ClF2/c12-7-11(3-4-11)6-8-1-2-9(13)10(14)5-8/h1-2,5H,3-4,6-7H2 |
| InChIKey | TVTWMDSFWICNND-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|