C15H17ClF2 — CID 82934973
2-(chloromethyl)-2-[(3,4-difluorophenyl)methyl]bicyclo[2.2.1]heptane (PubChem CID 82934973) has the molecular formula C15H17ClF2 and a molecular weight of 270.75 g/mol. Its IUPAC name is 2-(chloromethyl)-2-[(3,4-difluorophenyl)methyl]bicyclo[2.2.1]heptane.
| Compound Name | 2-(chloromethyl)-2-[(3,4-difluorophenyl)methyl]bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 82934973 |
| Molecular Formula | C15H17ClF2 |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(chloromethyl)-2-[(3,4-difluorophenyl)methyl]bicyclo[2.2.1]heptane |
| SMILES | Fc1ccc(CC2(CCl)CC3CCC2C3)cc1F |
| InChI | InChI=1S/C15H17ClF2/c16-9-15(7-10-1-3-12(15)5-10)8-11-2-4-13(17)14(18)6-11/h2,4,6,10,12H,1,3,5,7-9H2 |
| InChIKey | PASDQDOTUVWJRA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|