C15H17F4NO — CID 171963783
3-[4-fluoro-2-(trifluoromethyl)phenyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171963783) has the molecular formula C15H17F4NO and a molecular weight of 303.30 g/mol. Its IUPAC name is 3-[4-fluoro-2-(trifluoromethyl)phenyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[4-fluoro-2-(trifluoromethyl)phenyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171963783 |
| Molecular Formula | C15H17F4NO |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 3-[4-fluoro-2-(trifluoromethyl)phenyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CN1C2CCC1CC(O)(c1ccc(F)cc1C(F)(F)F)C2 |
| InChI | InChI=1S/C15H17F4NO/c1-20-10-3-4-11(20)8-14(21,7-10)12-5-2-9(16)6-13(12)15(17,18)19/h2,5-6,10-11,21H,3-4,7-8H2,1H3 |
| InChIKey | NQQVFIYTQUERAB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |