C15H20FNO2 — CID 171961585
3-(2-fluoro-5-methoxyphenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 171961585) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 3-(2-fluoro-5-methoxyphenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(2-fluoro-5-methoxyphenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 171961585 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-(2-fluoro-5-methoxyphenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | COc1ccc(F)c(C2(O)CC3CCC(C2)N3C)c1 |
| InChI | InChI=1S/C15H20FNO2/c1-17-10-3-4-11(17)9-15(18,8-10)13-7-12(19-2)5-6-14(13)16/h5-7,10-11,18H,3-4,8-9H2,1-2H3 |
| InChIKey | JCSLDDWYWITNQB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |