C18H25N3O5 — CID 55736035
tert-butyl N-[1-(4-methyl-3-nitrobenzoyl)piperidin-4-yl]carbamate (PubChem CID 55736035) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is tert-butyl N-[1-(4-methyl-3-nitrobenzoyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-methyl-3-nitrobenzoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55736035 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | tert-butyl N-[1-(4-methyl-3-nitrobenzoyl)piperidin-4-yl]carbamate |
| SMILES | Cc1ccc(C(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25N3O5/c1-12-5-6-13(11-15(12)21(24)25)16(22)20-9-7-14(8-10-20)19-17(23)26-18(2,3)4/h5-6,11,14H,7-10H2,1-4H3,(H,19,23) |
| InChIKey | HHXUIKAPHSQSLG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|