C21H30N2O5 — CID 55736625
tert-butyl N-[1-(3-methoxy-4-prop-2-enoxybenzoyl)piperidin-4-yl]carbamate (PubChem CID 55736625) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl N-[1-(3-methoxy-4-prop-2-enoxybenzoyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-methoxy-4-prop-2-enoxybenzoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55736625 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | tert-butyl N-[1-(3-methoxy-4-prop-2-enoxybenzoyl)piperidin-4-yl]carbamate |
| SMILES | C=CCOc1ccc(C(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)cc1OC |
| InChI | InChI=1S/C21H30N2O5/c1-6-13-27-17-8-7-15(14-18(17)26-5)19(24)23-11-9-16(10-12-23)22-20(25)28-21(2,3)4/h6-8,14,16H,1,9-13H2,2-5H3,(H,22,25) |
| InChIKey | GFHJJNYHCXFAPT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|