C25H33N3O5S — CID 55736695
tert-butyl N-[1-[3-(benzylsulfamoyl)-4-methylbenzoyl]piperidin-4-yl]carbamate (PubChem CID 55736695) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is tert-butyl N-[1-[3-(benzylsulfamoyl)-4-methylbenzoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-(benzylsulfamoyl)-4-methylbenzoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55736695 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | tert-butyl N-[1-[3-(benzylsulfamoyl)-4-methylbenzoyl]piperidin-4-yl]carbamate |
| SMILES | Cc1ccc(C(=O)N2CCC(NC(=O)OC(C)(C)C)CC2)cc1S(=O)(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H33N3O5S/c1-18-10-11-20(16-22(18)34(31,32)26-17-19-8-6-5-7-9-19)23(29)28-14-12-21(13-15-28)27-24(30)33-25(2,3)4/h5-11,16,21,26H,12-15,17H2,1-4H3,(H,27,30) |
| InChIKey | OKFOYTZJOUFIIC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |