C16H22FN3O4 — CID 53255560
tert-butyl N-[1-(4-fluoro-2-nitrophenyl)piperidin-4-yl]carbamate (PubChem CID 53255560) has the molecular formula C16H22FN3O4 and a molecular weight of 339.37 g/mol. Its IUPAC name is tert-butyl N-[1-(4-fluoro-2-nitrophenyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-fluoro-2-nitrophenyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 53255560 |
| Molecular Formula | C16H22FN3O4 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | tert-butyl N-[1-(4-fluoro-2-nitrophenyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ccc(F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H22FN3O4/c1-16(2,3)24-15(21)18-12-6-8-19(9-7-12)13-5-4-11(17)10-14(13)20(22)23/h4-5,10,12H,6-9H2,1-3H3,(H,18,21) |
| InChIKey | USELACXHOHHFFR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|