C16H20N4O4 — CID 77496342
tert-butyl N-[1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]carbamate (PubChem CID 77496342) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is tert-butyl N-[1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 77496342 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | tert-butyl N-[1-(2-cyano-4-nitrophenyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ccc([N+](=O)[O-])cc2C#N)C1 |
| InChI | InChI=1S/C16H20N4O4/c1-16(2,3)24-15(21)18-12-6-7-19(10-12)14-5-4-13(20(22)23)8-11(14)9-17/h4-5,8,12H,6-7,10H2,1-3H3,(H,18,21) |
| InChIKey | RZJWSMVZEIHSJJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|