C21H32N4O5 — CID 158069506
tert-butyl N-[(3R)-1-[4-(4-aminobutyl)-3-nitrobenzoyl]piperidin-3-yl]carbamate (PubChem CID 158069506) has the molecular formula C21H32N4O5 and a molecular weight of 420.51 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[4-(4-aminobutyl)-3-nitrobenzoyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[4-(4-aminobutyl)-3-nitrobenzoyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 158069506 |
| Molecular Formula | C21H32N4O5 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | tert-butyl N-[(3R)-1-[4-(4-aminobutyl)-3-nitrobenzoyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCN(C(=O)c2ccc(CCCCN)c([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C21H32N4O5/c1-21(2,3)30-20(27)23-17-8-6-12-24(14-17)19(26)16-10-9-15(7-4-5-11-22)18(13-16)25(28)29/h9-10,13,17H,4-8,11-12,14,22H2,1-3H3,(H,23,27)/t17-/m1/s1 |
| InChIKey | FLQQKTBZKWVWJI-QGZVFWFLSA-N |
| XLogP | 3.01 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|