C15H20N4O5 — CID 122702883
[1-[4-(ethylamino)-3-nitrobenzoyl]piperidin-3-yl]carbamic acid (PubChem CID 122702883) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is [1-[4-(ethylamino)-3-nitrobenzoyl]piperidin-3-yl]carbamic acid.
| Compound Name | [1-[4-(ethylamino)-3-nitrobenzoyl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 122702883 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [1-[4-(ethylamino)-3-nitrobenzoyl]piperidin-3-yl]carbamic acid |
| SMILES | CCNc1ccc(C(=O)N2CCCC(NC(=O)O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N4O5/c1-2-16-12-6-5-10(8-13(12)19(23)24)14(20)18-7-3-4-11(9-18)17-15(21)22/h5-6,8,11,16-17H,2-4,7,9H2,1H3,(H,21,22) |
| InChIKey | FPOQWJXUCSEDEN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|