C19H28N4O6 — CID 139433921
[1-[4-(2,2-dimethylpropylamino)-3-methoxy-5-nitrobenzoyl]piperidin-3-yl]carbamic acid (PubChem CID 139433921) has the molecular formula C19H28N4O6 and a molecular weight of 408.46 g/mol. Its IUPAC name is [1-[4-(2,2-dimethylpropylamino)-3-methoxy-5-nitrobenzoyl]piperidin-3-yl]carbamic acid.
| Compound Name | [1-[4-(2,2-dimethylpropylamino)-3-methoxy-5-nitrobenzoyl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 139433921 |
| Molecular Formula | C19H28N4O6 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [1-[4-(2,2-dimethylpropylamino)-3-methoxy-5-nitrobenzoyl]piperidin-3-yl]carbamic acid |
| SMILES | COc1cc(C(=O)N2CCCC(NC(=O)O)C2)cc([N+](=O)[O-])c1NCC(C)(C)C |
| InChI | InChI=1S/C19H28N4O6/c1-19(2,3)11-20-16-14(23(27)28)8-12(9-15(16)29-4)17(24)22-7-5-6-13(10-22)21-18(25)26/h8-9,13,20-21H,5-7,10-11H2,1-4H3,(H,25,26) |
| InChIKey | PHDDHEDPCCMBBV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|