C20H30N4O6 — CID 130366774
tert-butyl N-[(3R,6S)-1-[3-methoxy-4-(methylamino)-5-nitrobenzoyl]-6-methylpiperidin-3-yl]carbamate (PubChem CID 130366774) has the molecular formula C20H30N4O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is tert-butyl N-[(3R,6S)-1-[3-methoxy-4-(methylamino)-5-nitrobenzoyl]-6-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,6S)-1-[3-methoxy-4-(methylamino)-5-nitrobenzoyl]-6-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 130366774 |
| Molecular Formula | C20H30N4O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | tert-butyl N-[(3R,6S)-1-[3-methoxy-4-(methylamino)-5-nitrobenzoyl]-6-methylpiperidin-3-yl]carbamate |
| SMILES | CNc1c(OC)cc(C(=O)N2C[C@H](NC(=O)OC(C)(C)C)CC[C@@H]2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H30N4O6/c1-12-7-8-14(22-19(26)30-20(2,3)4)11-23(12)18(25)13-9-15(24(27)28)17(21-5)16(10-13)29-6/h9-10,12,14,21H,7-8,11H2,1-6H3,(H,22,26)/t12-,14+/m0/s1 |
| InChIKey | KFRYGEPZZPZVFS-GXTWGEPZSA-N |
| XLogP | 3.16 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|