C17H25N2O6P — CID 58071480
tert-butyl N-[1-(3-methoxy-4-nitrophenyl)-1-oxo-1λ5-phosphinan-4-yl]carbamate (PubChem CID 58071480) has the molecular formula C17H25N2O6P and a molecular weight of 384.37 g/mol. Its IUPAC name is tert-butyl N-[1-(3-methoxy-4-nitrophenyl)-1-oxo-1λ5-phosphinan-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-methoxy-4-nitrophenyl)-1-oxo-1λ5-phosphinan-4-yl]carbamate |
|---|---|
| PubChem CID | 58071480 |
| Molecular Formula | C17H25N2O6P |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | tert-butyl N-[1-(3-methoxy-4-nitrophenyl)-1-oxo-1λ5-phosphinan-4-yl]carbamate |
| SMILES | COc1cc(P2(=O)CCC(NC(=O)OC(C)(C)C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N2O6P/c1-17(2,3)25-16(20)18-12-7-9-26(23,10-8-12)13-5-6-14(19(21)22)15(11-13)24-4/h5-6,11-12H,7-10H2,1-4H3,(H,18,20) |
| InChIKey | NUMDBQIXBIIKBD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|