C17H26N4O5 — CID 169262186
tert-butyl N-[(3S,5R)-1-(2-methoxy-5-nitro-4-pyridinyl)-5-methylpiperidin-3-yl]carbamate (PubChem CID 169262186) has the molecular formula C17H26N4O5 and a molecular weight of 366.42 g/mol. Its IUPAC name is tert-butyl N-[(3S,5R)-1-(2-methoxy-5-nitro-4-pyridinyl)-5-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5R)-1-(2-methoxy-5-nitro-4-pyridinyl)-5-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 169262186 |
| Molecular Formula | C17H26N4O5 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | tert-butyl N-[(3S,5R)-1-(2-methoxy-5-nitro-4-pyridinyl)-5-methylpiperidin-3-yl]carbamate |
| SMILES | COc1cc(N2C[C@H](C)C[C@H](NC(=O)OC(C)(C)C)C2)c([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C17H26N4O5/c1-11-6-12(19-16(22)26-17(2,3)4)10-20(9-11)13-7-15(25-5)18-8-14(13)21(23)24/h7-8,11-12H,6,9-10H2,1-5H3,(H,19,22)/t11-,12+/m1/s1 |
| InChIKey | AFYAYYWQLVKWHQ-NEPJUHHUSA-N |
| XLogP | 2.74 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|