C20H26N4O3 — CID 129241241
tert-butyl N-[(3R,5S)-1-(8-formylquinoxalin-5-yl)-5-methylpiperidin-3-yl]carbamate (PubChem CID 129241241) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is tert-butyl N-[(3R,5S)-1-(8-formylquinoxalin-5-yl)-5-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,5S)-1-(8-formylquinoxalin-5-yl)-5-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 129241241 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | tert-butyl N-[(3R,5S)-1-(8-formylquinoxalin-5-yl)-5-methylpiperidin-3-yl]carbamate |
| SMILES | C[C@H]1C[C@@H](NC(=O)OC(C)(C)C)CN(c2ccc(C=O)c3nccnc23)C1 |
| InChI | InChI=1S/C20H26N4O3/c1-13-9-15(23-19(26)27-20(2,3)4)11-24(10-13)16-6-5-14(12-25)17-18(16)22-8-7-21-17/h5-8,12-13,15H,9-11H2,1-4H3,(H,23,26)/t13-,15+/m0/s1 |
| InChIKey | FLWBLVGSFDRMIU-DZGCQCFKSA-N |
| XLogP | 3.18 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|