C22H29N3O2 — CID 145336533
tert-butyl N-[(5S)-1-(8-ethenylquinolin-5-yl)-5-methylpiperidin-3-yl]carbamate (PubChem CID 145336533) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl N-[(5S)-1-(8-ethenylquinolin-5-yl)-5-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5S)-1-(8-ethenylquinolin-5-yl)-5-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 145336533 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | tert-butyl N-[(5S)-1-(8-ethenylquinolin-5-yl)-5-methylpiperidin-3-yl]carbamate |
| SMILES | C=Cc1ccc(N2CC(NC(=O)OC(C)(C)C)C[C@H](C)C2)c2cccnc12 |
| InChI | InChI=1S/C22H29N3O2/c1-6-16-9-10-19(18-8-7-11-23-20(16)18)25-13-15(2)12-17(14-25)24-21(26)27-22(3,4)5/h6-11,15,17H,1,12-14H2,2-5H3,(H,24,26)/t15-,17?/m0/s1 |
| InChIKey | AASSKMCECJZNNE-MYJWUSKBSA-N |
| XLogP | 4.62 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|