C19H25FN4O2 — CID 129276893
tert-butyl N-[1-(8-fluoroquinoxalin-5-yl)-5-methylpiperidin-3-yl]carbamate (PubChem CID 129276893) has the molecular formula C19H25FN4O2 and a molecular weight of 360.43 g/mol. Its IUPAC name is tert-butyl N-[1-(8-fluoroquinoxalin-5-yl)-5-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(8-fluoroquinoxalin-5-yl)-5-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 129276893 |
| Molecular Formula | C19H25FN4O2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | tert-butyl N-[1-(8-fluoroquinoxalin-5-yl)-5-methylpiperidin-3-yl]carbamate |
| SMILES | CC1CC(NC(=O)OC(C)(C)C)CN(c2ccc(F)c3nccnc23)C1 |
| InChI | InChI=1S/C19H25FN4O2/c1-12-9-13(23-18(25)26-19(2,3)4)11-24(10-12)15-6-5-14(20)16-17(15)22-8-7-21-16/h5-8,12-13H,9-11H2,1-4H3,(H,23,25) |
| InChIKey | OAURTMSHPJUJSY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |