C17H24N4O2S — CID 131734135
tert-butyl N-[(3S,5R)-1-(3-isothiocyanato-4-pyridinyl)-5-methylpiperidin-3-yl]carbamate (PubChem CID 131734135) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is tert-butyl N-[(3S,5R)-1-(3-isothiocyanato-4-pyridinyl)-5-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5R)-1-(3-isothiocyanato-4-pyridinyl)-5-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 131734135 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | tert-butyl N-[(3S,5R)-1-(3-isothiocyanato-4-pyridinyl)-5-methylpiperidin-3-yl]carbamate |
| SMILES | C[C@@H]1C[C@H](NC(=O)OC(C)(C)C)CN(c2ccncc2N=C=S)C1 |
| InChI | InChI=1S/C17H24N4O2S/c1-12-7-13(20-16(22)23-17(2,3)4)10-21(9-12)15-5-6-18-8-14(15)19-11-24/h5-6,8,12-13H,7,9-10H2,1-4H3,(H,20,22)/t12-,13+/m1/s1 |
| InChIKey | MJDLYIBETSGOPR-OLZOCXBDSA-N |
| XLogP | 3.56 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|