C17H21F3N4O2S — CID 123886627
tert-butyl N-[1-(3-isothiocyanato-4-pyridinyl)-5-(trifluoromethyl)piperidin-3-yl]carbamate (PubChem CID 123886627) has the molecular formula C17H21F3N4O2S and a molecular weight of 402.44 g/mol. Its IUPAC name is tert-butyl N-[1-(3-isothiocyanato-4-pyridinyl)-5-(trifluoromethyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-isothiocyanato-4-pyridinyl)-5-(trifluoromethyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 123886627 |
| Molecular Formula | C17H21F3N4O2S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | tert-butyl N-[1-(3-isothiocyanato-4-pyridinyl)-5-(trifluoromethyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(C(F)(F)F)CN(c2ccncc2N=C=S)C1 |
| InChI | InChI=1S/C17H21F3N4O2S/c1-16(2,3)26-15(25)23-12-6-11(17(18,19)20)8-24(9-12)14-4-5-21-7-13(14)22-10-27/h4-5,7,11-12H,6,8-9H2,1-3H3,(H,23,25) |
| InChIKey | ZQKFQBSTYLVROM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|