C16H22N4O2S — CID 89182986
tert-butyl N-[(3S)-1-(3-thiocyanato-4-pyridinyl)piperidin-3-yl]carbamate (PubChem CID 89182986) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(3-thiocyanato-4-pyridinyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(3-thiocyanato-4-pyridinyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 89182986 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | tert-butyl N-[(3S)-1-(3-thiocyanato-4-pyridinyl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCN(c2ccncc2SC#N)C1 |
| InChI | InChI=1S/C16H22N4O2S/c1-16(2,3)22-15(21)19-12-5-4-8-20(10-12)13-6-7-18-9-14(13)23-11-17/h6-7,9,12H,4-5,8,10H2,1-3H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | RLYWMOLMJDSSGW-LBPRGKRZSA-N |
| XLogP | 3.15 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|