C21H26BrN5O3 — CID 87669835
tert-butyl N-[1-[3-[(6-bromopyridine-2-carbonyl)amino]-4-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 87669835) has the molecular formula C21H26BrN5O3 and a molecular weight of 476.38 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[(6-bromopyridine-2-carbonyl)amino]-4-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[(6-bromopyridine-2-carbonyl)amino]-4-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 87669835 |
| Molecular Formula | C21H26BrN5O3 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | tert-butyl N-[1-[3-[(6-bromopyridine-2-carbonyl)amino]-4-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(c2ccncc2NC(=O)c2cccc(Br)n2)C1 |
| InChI | InChI=1S/C21H26BrN5O3/c1-21(2,3)30-20(29)24-14-6-5-11-27(13-14)17-9-10-23-12-16(17)26-19(28)15-7-4-8-18(22)25-15/h4,7-10,12,14H,5-6,11,13H2,1-3H3,(H,24,29)(H,26,28) |
| InChIKey | WGOFEUMIJBOWHJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|