C16H27N5O2 — CID 77473382
tert-butyl N-[1-[3-amino-2-(methylamino)-4-pyridinyl]piperidin-3-yl]carbamate (PubChem CID 77473382) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is tert-butyl N-[1-[3-amino-2-(methylamino)-4-pyridinyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-amino-2-(methylamino)-4-pyridinyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 77473382 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | tert-butyl N-[1-[3-amino-2-(methylamino)-4-pyridinyl]piperidin-3-yl]carbamate |
| SMILES | CNc1nccc(N2CCCC(NC(=O)OC(C)(C)C)C2)c1N |
| InChI | InChI=1S/C16H27N5O2/c1-16(2,3)23-15(22)20-11-6-5-9-21(10-11)12-7-8-19-14(18-4)13(12)17/h7-8,11H,5-6,9-10,17H2,1-4H3,(H,18,19)(H,20,22) |
| InChIKey | UMBZWFSKECNLJX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |