C16H21N3O2S — CID 122142851
tert-butyl N-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl)carbamate (PubChem CID 122142851) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is tert-butyl N-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl)carbamate.
| Compound Name | tert-butyl N-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl)carbamate |
|---|---|
| PubChem CID | 122142851 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | tert-butyl N-(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2ccnc3ccsc23)C1 |
| InChI | InChI=1S/C16H21N3O2S/c1-16(2,3)21-15(20)18-11-5-8-19(10-11)13-4-7-17-12-6-9-22-14(12)13/h4,6-7,9,11H,5,8,10H2,1-3H3,(H,18,20) |
| InChIKey | AMUZMXOTZGLUOT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |